Վիտամին H

քիմիական միացություն
Վիտամին H
Biotin structure.svg
Քիմիական բանաձևC₁₀H₁₆N₂O₃S
Մոլային զանգված244,088 զանգվածի ատոմական միավոր[1] գ/մոլ
Հալման ջերմաստիճան230 °C[2] °C
Քիմիական հատկություններ
Դասակարգում
CAS համար58-85-5
PubChem171548
EINECS համար200-399-3
SMILESC1C2C(C(S1)CCCCC(=O)O)NC(=O)N2
ЕС200-399-3
ChEBI149962
Եթե հատուկ նշված չէ, ապա բոլոր արժեքները բերված են ստանդարտ պայմանների համար (25 °C, 100 կՊա)

Վիտամին H (Բիոտին)Խմբագրել

Վիտամին H-ը (բիոտին, B7) պատկանում է ջրալույծ վիտամինների խմբին։ Այն սպիտակ գույնի բյուրեղիկների տեսքով է, որոնք լուծվում են ջրում և օրգանական լուծիչներում։ Մասնակցում է ճարպաթթուների և գլիկոգենի սինթեզին։ Ոչնչանում է բարձր ջերմաստիճանի դեպքում։ Օրգանիզմի օրական պահանջը բիոտինի նկատմամբ կազմում է 30-80 մկգ։ Հղի կանանց դեպքում՝ 50-110 մկգ։

Վիտամին H-ի կենսաբանական դերըԽմբագրել

  1. Կարգավորում է շաքարի մակարդակը արյան մեջ, ինչպես նաև գլյուկոզի մասնակցությունը նյութափոխանակությանը։
  2. Ունի մեծ դեր սպիտակուցների յուրացման և ճարպերի այրման մեջ։
  3. Բիոտինը կարևոր է մազերի, եղունգների և մաշկի համար, ինչի համար էլ ստացել է «գեղեցկության վիտամին» անվանումը։
  4. Ունի մեծ դեր նյարդային համակարգի նորմալ գործունեության համար։

Բիոտինի թերվիտամինոզ և հիպերվիտամինոզԽմբագրել

Օրգանիզմում բիոտինի անբավարար քանակության դեպքում արյան մեջ շաքարի և խոլեստերինի քանակը դառնում է անկայուն։ Կարող է առաջանալ անեմիա, ի հայտ է գալիս ընդհանուր թուլություն, ախորժակի կորուստ, դեպրեսիա։ Վիատմին H-ի անբավարարության նշաններ են մազաթափությունը, չոր մաշկը, ճարպակալումը։ Այս զարմանահրաշ վիտամինի հիպերվիտամինոզը չի առաջացնում որևէ խնդիր։

Բիոտինի քանակը տարբեր մթերքներումԽմբագրել

Բիոտին պարունակվում է բոլոր այն մթերքներում, որոնք օգտագործում ենք։

Մթերքը(100 գ) Պարունակվող քանակը
Տավարի լյարդ 98 մկգ
Խոզի լյարդ 80 մկգ
Եգիպտացորեն 21 մկգ
Հավի ձու 20․2 մկգ
Վարսակի փաթիլներ 20 մկգ
Ոլոռ 19 մկգ
Ցորեն 10․5 մկգ
Թառափ 10 մկգ
Պիստակ 10 մկգ
Հավի միս 10 մկգ
Վայրի ելակ 4 մկգ
Սերուցք 4 մկգ
Թթվասեր 3․6 մկգ
Պանիր 3․6 մկգ
Չիչխան 3․3 մկգ

Բիոտինի յուրացման խանգարումներըԽմբագրել

Ձվի սպիտակուցում պարունակվում է ավիդին, որը խանգարում է բիոտինի յուրացմանը։ Հակաբիոտիկները և ալկոհոլը նույնպես խանգարում են բիոտինի սինթեզին և ներծծմանը։ Վիտամին H-ի ակտիվությունը բարձրացնելու համար խորհուրդ է տրվում համատեղել այն մագնեզիումի հետ։

ԾանոթագրություններԽմբագրել