«Ադենոզինեռֆոսֆատ»–ի խմբագրումների տարբերություն

Առանց խմբագրման ամփոփման
(ավելացվեց Կատեգորիա:Կոֆերմենտներ ՀոթՔաթ գործիքով)
| պատկեր 3D = ATP-xtal-3D-balls.png
| պատկեր 2 = Atp exp.qutemol-ball.png
| քիմիական անվանում =
| ավանդական անվանում = 5-(6-ամինոպուրին-9-իլ)-3,4-դիհիդրօքսի-օքսոլան-2-իլ-մեթօքսի-հիդրօքսի-ֆոսֆորիլ-օքսի-հիդրօքսի-ֆոսֆորիլ օքսիֆոսֆոնաթթու
| քիմիական բանաձև =
| այլ անվանումներ = ԱԵՖ, Ադենոզինեռֆոսֆորական թթու
| ռացիոնալ բանաձև = C<sub>10</sub>H<sub>16</sub>N<sub>5</sub>O<sub>13</sub>P<sub>3</sub>
| վիճակ =
| արտաքին տեսք=
| մոլյար կոնցենտրացիա =
| ամրության սահման =
| կարծրություն =
| մակերեսային լարվածություն =
| դինամիկ մածուցիկություն =
| կինեմատիկ մածուցիկություն =
| իոնիզացման էներգիա =
| հաղորդականություն =
| էլեկտրական դիմադրություն =
| էլ. դիմ գործակից =
| ձայնի արագություն =
| մոլային զանգված = 507,18
| խտություն =
| հալման ջերմ. =
| եռման ջերմ. =
| բռնկման ջերմ. =
| փափկեցման ջերմ. =
| սուբլիմացման ջերմ. =
| եռման ջերմ. բն. =
| ֆազային անցումներ =
| այրման ջերմ. =
| բյուրեղացման ջերմ. =
| ինքնաայրման ջերմ. =
| գազի ճնշում =
| պայթուցիկության աստիճան =
| Վան դեր Վալսի հաստ. =
| տրանսֆորմացիայի միջակայք =
| հալման տեսակ. ջերմուն. =
| սուբլիմացիայի էնթալպիա =
| գազառաջացման տեսակ. ջերմուն. =
| ջերմային լայնացում =
| լուծման էնթալպիա =
| եռման էնթալպիա =
| հալման էնթալպիա =
| ձևավորման էնթալպիա =
| ջերմահաղորդականություն =
| կրիտիկական խտություն =
| ջերմատարողություն =
| կրիտիկական ճնշում =
| եռակի կետ =
| թթվի չեզոք. հաստ. =
| լուծելիություն = (20&nbsp;°C) - 5
| լուծելիություն1 =
| նյութ1 =
| լուծելիություն2 =
| նյութ2 =
| լուծելիություն3 =
| նյութ3 =
| լուծելիություն4 =
| նյութ4 =
| պտույտ =
| իզոէլեկտրական կետ =
| դիէլեկտր. թափանց. =
| թափանցիկություն =
| բեկման ցուցիչ =
| Բրյուստերի անկյուն =
| հիբրիդիզացիա =
| կոորդինացիոն երկրաչափություն =
| բյուրեղային կառուցվածք =
| դիպոլ մոմենտ =
| CAS = 56-65-5
| PubChem = 5957
| EINECS =
| SMILES = Nc1ncnc2c1ncn2C3OC(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C3O
| EC =
| RTECS =
| ChEBI =
| OOH =
| ՍԹԿ =
| ՄԲ =
| թունավորություն =
| R-արժեքներ =
| S-արժեքներ =
| H-արժեքներ =
| P-արժեքներ =
| ԳՀՀ=
| NFPA =
}}
 
 
== Ֆունկցիաները բջջում ==
 
=== Նյութափոխանակություն և սինթեզ ===
ԱԵՖ-ը ծախսվում է բջջում որպես էներգիա էներգետիկ և պլաստիկ փոխանակությունների համար։ Այսպես ԱԵՖ-ը էներգիա է ապահովում տարբեր տեղեր ընթացող նյթափոխանակության ռեակցիաների համար։ ԱԵՖ-ը էներգիայի գլխավոր աղբյուրն է բջջային ռեակցիաների համար։ Սա ընդգրկում է սինթեզի ռեակցիաները, ներառյալ ԴՆԹ-ի մոլեկուլի սինթեզը և ՌՆԹ-ի տրանսկրիպցիան։ ԱԵՖ-ը նաև կարևոր դեր ունի ակտիվ տեղափոխության մեջ, բջջի պլազմային թաղանթով։ Օրինակ էնդոցիտոզը և էկտոցիտոզը։
170 607

edits