«Ադենոզինեռֆոսֆատ»–ի խմբագրումների տարբերություն

Հետ է շրջվում 3168003 խմբագրումը, որի հեղինակն է՝ ԱշոտՏՆՂ (քննարկում) մասնակիցը
(Հետ է շրջվում 3168003 խմբագրումը, որի հեղինակն է՝ ԱշոտՏՆՂ (քննարկում) մասնակիցը)
| պատկեր = Adenosintriphosphat protoniert.svg
| պատկեր 3D = ATP-xtal-3D-balls.png
| պատկեր 2 = Atp exp.qutemol-ball.png
| քիմիական անվանում =
| ավանդական անվանում = <!-- 5-(6-aminopurin-9-yl)<br />-3,4-dihydroxy-oxolan-2-yl<br />methoxy-hydroxy-phosphoryl<br />oxy-hydroxy-phosphoryl oxyphosphonic acid -->
| քիմիական բանաձև =
| այլ անվանումներ = ԱԵՖ, Ադենոզինեռֆոսֆորական թթու
| ռացիոնալ բանաձև = C<sub>10</sub>H<sub>16</sub>N<sub>5</sub>O<sub>13</sub>P<sub>3</sub>
| վիճակ =
| արտաքին տեսք=
| մոլային զանգված =
| մոլյար կոնցենտրացիա =
| ամրության սահման =
| կարծրություն =
| մակերեսային լարվածություն =
| դինամիկ մածուցիկություն =
| կինեմատիկ մածուցիկություն =
| իոնիզացման էներգիա =
| հաղորդականություն =
| էլեկտրական դիմադրություն =
| էլ. դիմ գործակից =
| ձայնի արագություն =
| մոլային զանգված = 507,18
| խտություն =
| հալման ջերմ. =
| եռման ջերմ. =
| բռնկման ջերմ. =
| փափկեցման ջերմ. =
| սուբլիմացման ջերմ. =
| եռման ջերմ. բն. =
| ֆազային անցումներ =
| այրման ջերմ. =
| բյուրեղացման ջերմ. =
| ինքնաայրման ջերմ. =
| գազի ճնշում =
| պայթուցիկության աստիճան =
| Վան դեր Վալսի հաստ. =
| տրանսֆորմացիայի միջակայք =
| հալման տեսակ. ջերմուն. =
| սուբլիմացիայի էնթալպիա =
| գազառաջացման տեսակ. ջերմուն. =
| ջերմային լայնացում =
| լուծման էնթալպիա =
| եռման էնթալպիա =
| հալման էնթալպիա =
| ձևավորման էնթալպիա =
| ջերմահաղորդականություն =
| կրիտիկական խտություն =
| ջերմատարողություն =
| կրիտիկական ճնշում =
| եռակի կետ =
| թթվի չեզոք. հաստ. =
| լուծելիություն = ջրում լուծելիությունը (20&nbsp;°C) - 5
| լուծելիություն1 =
| նյութ1 =
| լուծելիություն2 =
| նյութ2 =
| լուծելիություն3 =
| նյութ3 =
| լուծելիություն4 =
| նյութ4 =
| պտույտ =
| իզոէլեկտրական կետ =
| դիէլեկտր. թափանց. =
| թափանցիկություն =
| բեկման ցուցիչ =
| Բրյուստերի անկյուն =
| հիբրիդիզացիա =
| կոորդինացիոն երկրաչափություն =
| բյուրեղային կառուցվածք =
| դիպոլ մոմենտ =
| CAS = 56-65-5
| PubChem = 5957
| SMILES = Nc1ncnc2c1ncn2C3OC(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C3O
| EC =
| ChEBI =
| OOH =
| ՍԹԿ =
| ՄԲ =
| թունավորություն =
| R-արժեքներ =
| S-արժեքներ =
| H-արժեքներ =
| P-արժեքներ =
| ԳՀՀ=
| NFPA =
'''Ադենոզինեռֆոսֆատ''' (ԱԵՖ, {{lang-en|АТР}}), միացություն է՝ հայտնի որպես էներգիայի աղբյուր բոլոր կենդանի օրգանիզմների և դրանցում ընթացող կենսաքիմիական ռեակցիաների համար։ Բջջում օգտագործվում է նյութափոխանակության և էներգիական փոխանակության համար։ ԱԵՖ-ը բացահայտվել է 1929 թվականին, Հարվարդի բժշկական դպրոցի մի խումբ գիտնականների՝ Կարլ Լոհմանի, Սիրուս Ֆիսկեի և Ե. Սաբարոուի կողմից<ref>Lohmann, K. (1929) ''Über die Pyrophosphatfraktion im Muskel.'' Naturwissenschaften 17, 624—625.</ref>։ Իսկ 1941 թվականին Ֆրից Լիպմանը ապացուցեց, որ ԱԵՖ-ը բջջում հանդիսանում է էներգիայի գլխավոր կրիչ<ref>Lipmann F. (1941) ''Adv. Enzymol.'' 1, 99-162.</ref>։