«Ադենոզինեռֆոսֆատ»–ի խմբագրումների տարբերություն

Առանց խմբագրման ամփոփման
չ (→‎Աղբյուրներ: Լավ/Ընտրյալ հոդվածի կամ ցանկի կաղապարների հեռացում: Այժմ Վիքիշտեմարանից է գալիս։, ջնջվեց: {{Link GA|cs}} (2))
{{Նյութ
[[Պատկեր:Adenosintriphosphat protoniert.svg|մինի|250px|Ադենոզինեռաֆոսֆատի կառույցը]]
| պատկեր = Adenosintriphosphat protoniert.svg
| պատկեր 3D = ATP-xtal-3D-balls.png
| պատկեր 2 = Atp exp.qutemol-ball.png
| քիմիական անվանում =
| ավանդական անվանում = <!-- 5-(6-aminopurin-9-yl)<br />-3,4-dihydroxy-oxolan-2-yl<br />methoxy-hydroxy-phosphoryl<br />oxy-hydroxy-phosphoryl oxyphosphonic acid -->
| քիմիական բանաձև =
| այլ անվանումներ = ԱԵՖ, Ադենոզինեռֆոսֆորական թթու
| ռացիոնալ բանաձև = C<sub>10</sub>H<sub>16</sub>N<sub>5</sub>O<sub>13</sub>P<sub>3</sub>
| վիճակ =
| արտաքին տեսք=
| մոլային զանգված =
| մոլյար կոնցենտրացիա =
| խտություն =
| ամրության սահման =
| կարծրություն =
| մակերեսային լարվածություն =
| դինամիկ մածուցիկություն =
| կինեմատիկ մածուցիկություն =
| իոնիզացման էներգիա =
| հաղորդականություն =
| էլեկտրական դիմադրություն =
| էլ. դիմ գործակից =
| ձայնի արագություն =
| մոլային զանգված = 507,18
| խտություն =
| հալման ջերմ. =
| եռման ջերմ. =
| բռնկման ջերմ. =
| ջերմատարողություն =
| ձևավորման էնթալպիա =
| լուծելիություն =
| հալման ջերմ. =
| փափկեցման ջերմ. =
| սուբլիմացման ջերմ. =
| եռման ջերմ. =
| եռման ջերմ. բն. =
| տրոհման ջերմ. =
| տրոհման ջերմ. =
| ֆազային անցումներ =
| այրման ջերմ. =
| բյուրեղացման ջերմ. =
| բռնկման ջերմ. =
| ինքնաայրման ջերմ. =
| գազի ճնշում =
| պայթուցիկության աստիճան =
| Վան դեր Վալսի հաստ. =
| տրանսֆորմացիայի միջակայք =
| հալման տեսակ. ջերմուն. =
| սուբլիմացիայի էնթալպիա =
| գազառաջացման տեսակ. ջերմուն. =
| ջերմային լայնացում =
| լուծման էնթալպիա =
| եռման էնթալպիա =
| հալման էնթալպիա =
| ձևավորման էնթալպիա =
| ջերմահաղորդականություն =
| կրիտիկական խտություն =
| ջերմատարողություն =
| կրիտիկական ճնշում =
| եռակի կետ =
| թթվի չեզոք. հաստ. =
| լուծելիություն = ջրում լուծելիությունը (20&nbsp;°C) - 5
| լուծելիություն =
| լուծելիություն1 =
| նյութ1 =
| լուծելիություն2 =
| նյութ2 =
| լուծելիություն3 =
| նյութ3 =
| լուծելիություն4 =
| նյութ4 =
| պտույտ =
| իզոէլեկտրական կետ =
| դիէլեկտր. թափանց. =
| թափանցիկություն =
| բեկման ցուցիչ =
| Բրյուստերի անկյուն =
| հիբրիդիզացիա =
| կոորդինացիոն երկրաչափություն =
| բյուրեղային կառուցվածք =
| դիպոլ մոմենտ =
| CAS = 56-65-5
| PubChem = 5957
| EINECS =
| SMILES = Nc1ncnc2c1ncn2C3OC(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C3O
| EC =
| RTECS =
| ChEBI =
| OOH =
| ՍԹԿ =
| ՄԲ =
| թունավորություն =
| R-արժեքներ =
| S-արժեքներ =
| H-արժեքներ =
| P-արժեքներ =
| ԳՀՀ=
| NFPA =
}}
 
'''Ադենոզինեռֆոսֆատ''' (ԱԵՖ, {{lang-en|АТР}}), միացություն է՝ հայտնի որպես էներգիայի աղբյուր բոլոր կենդանի օրգանիզմների և դրանցում ընթացող կենսաքիմիական ռեակցիաների համար: Բջջում օգտագործվում է նյութափոխանակության և էներգիական փոխանակության համար: ԱԵՖ-ը բացահայտվել է 1929 թվականին, Հարվարդի բժշկական դպրոցի մի խումբ գիտնականների՝ Կարլ Լոհմանի, Սիրուս Ֆիսկեի և Ե. Սաբարոուի կողմից<ref>Lohmann, K. (1929) ''Über die Pyrophosphatfraktion im Muskel.'' Naturwissenschaften 17, 624—625.</ref>: Իսկ 1941 թվականին Ֆրից Լիպմանը ապացուցեց, որ ԱԵՖ-ը բջջում հանդիսանում է էներգիայի գլխավոր կրիչ<ref>Lipmann F. (1941) ''Adv. Enzymol.'' 1, 99-162.</ref>:
'''Ադենոզին-5'-եռաֆոսֆատը''' կամ '''Ադենոզինեռաֆոսֆատը''' ('''ԱԵՖ''') (անգլերեն՝ ''Adenosine triphosphate'' (''ATP''), կարդացվում է՝ ''ըդենոզին թրայֆասֆեյթ'') բազմագործունյա [[նուկլեոտիդ]] է, որը [[բջջաբանություն|բջջաբանության]] մեջ կարևոր դեր է կատարում որպես [[կոֆերմենտ]], այսինքն՝ «[[մոլեկուլ]]ային միավորի [[արժույթ]]ի» դեր է կատարում միջաբջջային [[էներգիա]]յի տեղափոխման համար։<ref>{{cite journal |author=Knowles JR |title=Enzyme-catalyzed phosphoryl transfer reactions (անգլերեն)|journal=Annu. Rev. Biochem. |volume=49 |issue= |pages=877–919 |year=1980 |pmid=6250450 | doi=10.1146/annurev.bi.49.070180.004305}}</ref> ԱՏՖ-ն էներգիան բջիջների մեջ տեղափոխում է [[նյութափոխականություն|նյութափոխականության]] (մետաբոլիզմի) նպատակով։ Դա մի էներգիայի պահեստ է, որը սարքվում է [[ֆոտոսինթեզ]]ի և [[բջջային շնչառություն|բջջային շնչառության]] ժամանակ և սպառվում բազում [[ֆերմենտ]]ների և բջջային գործընթացների միջոցով, որոնցից են [[կենսասինթեզ|կենսասինթետիկ ռեակցիաները]], [[շարժունակյուն]]ը և [[բջջի բաժանում]]ը։<ref>{{cite book | last = Campbell | first = Neil A. | authorlink = | coauthors = Brad Williamson; Robin J. Heyden | title = Biology: Exploring Life (անգլերեն)| publisher = Pearson Prentice Hall | date = 2006 | location = Boston, Massachusetts | url = http://www.phschool.com/el_marketing.html | isbn = 0-13-250882-6 }}</ref> ԱՏՖ-ն սարքվում է [[ադենոզինկրկնաֆոսֆատ]]ից (ԱԴՖ) կամ [[ադենոզինմիաֆոսֆատ]]ից (ԱՄՖ), և նյուափոխանակության ընթացքում օգտագործվելը նրան վերադարձնում է այդ նախնիներին։ Այդ պատճառով ԱՏՖ-ն շարունակաբար վերամշակվում է օրգանիզմներում, այնպես որ մարդկային մարմինը իր սեփական կշռի չափ ԱՏՖ է շրջում ամեն օր։<ref>{{cite journal |author=Törnroth-Horsefield S, Neutze R |title=Opening and closing the metabolite gate (անգլերեն)|journal=Proc. Natl. Acad. Sci. U.S.A. |volume=105 |issue=50 |pages=19565–6 |year=2008 |month=December |pmid=19073922 |doi=10.1073/pnas.0810654106 |url=http://www.pnas.org/cgi/pmidlookup?view=long&pmid=19073922}}</ref>
 
== Քիմիական և ֆիզիկական հատկություններ ==
== Աղբյուրներ ==
ԱԵՖ-ը իր մեջ պարունակում է ադենոզին՝ կազմված ադենին ազոտական հիմքից և ռիբոզ ածխաջրից, և երեք ֆոսֆորական թթվի մնացորդներ: Ֆոսֆորական խմբերը որոնք մոտիկ են ռիբոզին նաշվում են որպես ալֆա (α), բետա (β), և գամա (γ) ֆոսֆատներ: Հետևաբար դա սերտորեն կապված է ՌՆԹ-ի մոնոմեր ադենոզին նուկլեոտիդի հետ: ԱԵՖ-ը լավ լուծվում է ջրում և բավականին կայուն է pH&nbsp;6.8 և 7.4 միջև, բայց արագ ենթարկվում է հիդրոլիզի չափազանց մեծ pH-ի ժամանակ: Քիմիապես ԱԵՖ-ը իրենից ներկայացնում է ադենոզինի եռֆոսֆատ եթեր, որը հանդես է գալիս որպես ադենինի և ռիբոզի ածանցյալ: Պուրինինային ազոտային հիմքը՝ ադենինը, կապվում է ռիբոզի մեկ ածխաթթվի հետ: ԱԵՖ-ը հիմնականում գտնվում է աղի վիճակով:<ref>{{cite book| editor=Stecher, P. G. | year=1968 | title=The Merck Index: an encyclopedia of chemicals and drugs 8th edition |publisher= Merck and Co. Ltd.}}</ref>
{{reflist}}
 
== Կենսասինթեզ ==
[[Կատեգորիա:Բջջային շնչառություն]]
ԱԵՖ-ը բջջի մեջ կազմում է 1-10 մոլ: ԱԵՖ-ը առաջանում է օքսիդավերականգման ռեակցիաների արդյունքում, օգտագործելով միշաքարներ կամ բազմաշաքարներ որպես էներգիայի աղբյուր: Օրինակ կարբոհիդրատները հիդրոլիզի են ենթարկվում մինչև միաշաքարներ ինչպիսին են գլյուկոզը և սախարոզը:
[[Կատեգորիա:Նուկլեոտիդներ]]
[[Կատեգորիա:Կոֆերմենտներ]]
[[Կատեգորիա:Նյութափոխանակություն]]
 
Գլյուկոզի օքսիդացումը ածխաթթու գազի հայտնի է ինչպես բջջային շնչառություն և կարող է առաջացնել մոտ 30 մոլեկուլ ԱԵՖ մեկ գլյուկոզի մոլեկուլից:<ref name=Rich>{{cite journal |author=Rich PR |title=The molecular machinery of Keilin's respiratory chain |journal=Biochem. Soc. Trans. |volume=31 |issue=Pt 6 |pages=1095–105 |year=2003 |pmid=14641005 |url=http://www.biochemsoctrans.org/bst/031/1095/bst0311095.htm |doi=10.1042/BST0311095}}</ref> ԱԵՖ կարող է արտադրվել մի շարք բջջային ռեակցիաների արդյունքում: Էուկարիոտ օրգանիզմների էներգիա ստանալու երեք հիմնական ձևերն են՝ գլիկոլիզը, եռկարբոնաթթվի ցիկլ, երկուսը իրար հետ կազմում են բջջային շնչառությունը և բետաօքսիդացումը: Մեծ մասամբ ԱԵՖ-ը սինթեզվում է միտոքոնդրրումներում, որը կազմում է մասնագիտացված բջջի ամբողջ ծավալի մոտավորապես 25%-ը:<ref name="Lodish">{{cite book | author=Lodish H Berk A, Matsudaira P, Kaiser CA, Krieger M, Scott MP, Zipursky SL, Darnell J. | title=Molecular Cell Biology |edition=5th |publisher=WH Freeman |location=New York |isbn = 978-0-7167-4366-8 | year=2004 }}</ref>
 
== Ֆունկցիաները բջջում ==
{{chem-stub}}
 
=== Նյութափոխանակություն և սինթեզ ===
ԱԵՖ-ը ծախսվում է բջջում որպես էներգիա էներգետիկ և պլաստիկ փոխանակությունների համար: Այսպես ԱԵՖ-ը էներգիա է ապահովում տարբեր տեղեր ընթացող նյթափոխանակության ռեակցիաների համար: ԱԵՖ-ը էներգիայի գլխավոր աղբյուրն է բջջային ռեակցիաների համար: Սա ընդգրկում է սինթեզի ռեակցիաները, ներառյալ ԴՆԹ-ի մոլեկուլի սինթեզը և ՌՆԹ-ի տրանսկրիպցիան: ԱԵՖ-ը նաև կարևոր դեր ունի ակտիվ տեղափոխության մեջ, բջջի պլազմային թաղանթով: Օրինակ էնդոցիտոզը և էկտոցիտոզը:
 
 
=== Դերը բջջի կառուցվածքի և շարժման մեջ ===
ԱԵՖ-ը ընդգրկված է բջջի կառուցվածքի մեջ և հեշտացնում է ցիտոկմախքի տարրերի միավորումն ու տարրանջատումը: Մկանների կծկումների համար նույնպես անհրաժեշտ է ԱԵՖ: Այս գործընթացն էներգիայի հիմնական սպառիչն է և պարտադիր է կենդանիների շարժման համար: