Բացել գլխավոր ցանկը

Կապարի ազիդ

քիմիական միացություն

Կապարի ազիդ, Pb(Na3)2, ազոտաջրածնական թթվի (HNO3) կապարի աղը։ Սպիտակ բյուրեղներ են, խտությունը՝ 4700 կգ/մ3։ Ջրում չի լուծվում։ Խթանիչ պայթուցիկ նյութ է։

Կապարի ազիդ
Lead(II)azide.svg
Քիմիական բանաձևN₆Pb
Մոլային զանգված291,995 զանգվածի ատոմական միավոր[1] գ/մոլ
Կազմալուծման ջերմաստիճան240 °C
Այրման ջերմաստիճան330 °C
Քիմիական հատկություններ
Լուծելիությունը ջրում0,023 գ/100 մլ
Դասակարգում
CAS համար13424-46-9
PubChem61600
EINECS համար236-542-1
SMILES[N-]=[N+]=N[Pb]N=[N+]=[N-]
ЕС236-542-1
RTECSOF8650000
ChEBI21250825, 55508
Եթե հատուկ նշված չէ, ապա բոլոր արժեքները բերված են ստանդարտ պայմանների համար (25 °C, 100 կՊա)

Ստացվում է NaN3-ի և Pb(N03)2֊ի փոխազդեցությունից։ Կիրառվում է պարկուճ-դետոնատորներում։

ԾանոթագրություններԽմբագրել

  1. 1,0 1,1 Lead diazide
Այս հոդվածի կամ նրա բաժնի որոշակի հատվածի սկզբնական կամ ներկայիս տարբերակը վերցված է Քրիեյթիվ Քոմմոնս Նշում–Համանման տարածում 3.0 (Creative Commons BY-SA 3.0) ազատ թույլատրագրով թողարկված Հայկական սովետական հանրագիտարանից  (հ․ 5, էջ 250